Butanamide, 3,3-dimethyl-N-(4-nitrophenyl)-
CAS No: 87315-20-6
873111-83-2
4-Pyridinecarboxylic acid, (2E)-[(2,4-dinitrophenyl)methylene]hydrazide
87317-07-5
Benzenesulfonamide, N-(2-chloro-5-nitrophenyl)-3-nitro-
87316-97-0
Benzenesulfonamide, N-(2,4-dichlorophenyl)-2-methyl-5-nitro-
87315-06-8
2H-Pyran-2-one, 3-(1,1-dimethyl-2-propenyl)-4-methoxy-6-phenyl-
87316-92-5
Benzenesulfonamide, 4-methyl-N-(4-methyl-2-nitrophenyl)-3-nitro-
87315-20-6
Butanamide, 3,3-dimethyl-N-(4-nitrophenyl)-
87314-88-3
1H-Imidazole-1-ethanol,a-(4-chlorophenyl)-b-(1,1-dimethylethoxy)-a-methyl-
87316-98-1
Benzenesulfonamide, N-(2,5-dichlorophenyl)-2-methyl-5-nitro-
87315-09-1
(αR)-4-Carboxy-α,2-dihydroxybenzenepropanoic acid
87318-65-8
3(2H)-ISOXAZOLONE,5-(2-OXOPROPYL)-
87317-01-9
Benzenesulfonamide, N-(2-chloro-4-nitrophenyl)-2-methyl-5-nitro-
87317-84-8
4(1H)-Pyrimidinone, 2-amino-, monohydrochloride
87316-17-4
(1S,3R,6α)-3β-Ethyl-4α-hydroxytricyclo[4.3.0.01,5]nonane-5β-carboxylic acid [2α-(1-methylethyl)-5β-methylcyclohexan-1β-yl] ester
873112-77-7
Benzamide, 2-[(5-chloro-2-nitrophenyl)thio]-N,N-dimethyl-
873-12-1
Spiro[4.4]nonan-1-ene
87314-78-1
1H-Imidazole-1-ethanol, a-(1,1-dimethylethyl)-a-ethenyl-b-methoxy-
87316-96-9
Benzenesulfonamide, N-(4-iodophenyl)-2-methyl-5-nitro-
87317-56-4
Ethanesulfonic acid, 2-[(5-amino-1,3,4-thiadiazol-2-yl)thio]-,monosodium salt
87317-02-0
Benzenesulfonamide, N-(3-chlorophenyl)-3-nitro-
87316-99-2
Benzenesulfonamide, N-(3,5-dichlorophenyl)-2-methyl-5-nitro-
87315-20-6
butanamide,dimethyl,nitrophenyl,87315-20-6
2025-10-20 Discover Butanamide, 3,3-dimethyl-N-(4-nitrophenyl)- (CAS No: 87315-20-6) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.